![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 12_Cytoskeleton.pdf | 2020-05-10 21:24 | 16M | |
| 40632_ch08_rev151_18..> | 2020-04-09 16:30 | 9.8M | |
| 195149263319.pdf | 2020-04-09 16:49 | 135K | |
| ALLERGY.pdf | 2020-04-26 20:58 | 468K | |
| Antigen-Antibody int..> | 2020-06-01 20:09 | 1.0M | |
| Aortic Arch.pdf | 2020-04-26 20:58 | 4.3M | |
| BODY FLUIDS AND ..> | 2020-04-26 20:58 | 2.1M | |
| Biomembrane.pdf | 2020-04-19 00:33 | 912K | |
| Cancer.pdf | 2020-04-06 01:15 | 1.3M | |
| Chap-131.pdf | 2020-04-09 16:48 | 108K | |
| Classification of Ar..> | 2020-05-06 14:26 | 1.2M | |
| Coevolution_UG Sem-V..> | 2020-05-17 20:22 | 814K | |
| Community.pdf | 2020-04-05 00:25 | 1.9M | |
| Course Material_Exti..> | 2020-04-28 23:13 | 20M | |
| D24.PDF | 2020-05-25 00:24 | 534K | |
| DifferenceBetweenApo..> | 2020-05-10 21:22 | 1.1M | |
| Digestion and Absorp..> | 2020-04-21 02:34 | 4.3M | |
| Document (16)-1.pdf | 2020-05-25 00:24 | 408K | |
| Document (17).pdf | 2020-05-25 00:24 | 322K | |
| Document (18).pdf | 2020-05-25 00:24 | 337K | |
| Document (19).pdf | 2020-05-25 00:24 | 2.2M | |
| Document (21).pdf | 2020-05-25 00:24 | 190K | |
| Document (23).pdf | 2020-05-25 00:24 | 301K | |
| ELISA-1.pdf | 2020-06-01 20:09 | 666K | |
| ENDOCRINE.pdf | 2020-04-05 00:05 | 2.0M | |
| Entomology54321.pdf | 2020-04-22 23:18 | 1.5M | |
| Evolution of Men.pdf | 2020-04-22 23:18 | 528K | |
| Fish_Migration.pdf | 2020-04-05 00:31 | 1.2M | |
| Functional anatomy a..> | 2020-04-21 02:31 | 1.7M | |
| GOPE_Fatty_Liver.pdf | 2020-04-08 18:33 | 1.0M | |
| Gope_Electron.pdf | 2020-04-07 11:38 | 1.3M | |
| Heritable variation.pdf | 2020-04-26 20:58 | 155K | |
| Host - Plant selecti..> | 2020-05-15 16:50 | 767K | |
| Hybridoma Technology..> | 2020-06-01 20:09 | 390K | |
| Hypothalamus.pdf | 2020-04-19 00:33 | 614K | |
| INSECT_TRACHEAL.pdf | 2020-04-05 01:15 | 327K | |
| Insect_Antennae.pdf | 2020-04-05 01:14 | 164K | |
| JPB2015.pdf | 2020-05-10 21:23 | 352K | |
| Jan102013.pdf | 2020-04-05 01:24 | 187K | |
| MS-Treatmentcontrolo..> | 2020-04-09 16:49 | 1.0M | |
| Microscopy.pdf | 2020-04-13 23:31 | 2.5M | |
| Mitosis and Meiosis_..> | 2020-05-09 19:55 | 6.3M | |
| Mode _s.pdf | 2020-04-06 01:15 | 311K | |
| Mode_s.pdf | 2020-04-06 01:16 | 311K | |
| Modification.pdf | 2020-04-05 01:15 | 202K | |
| Molecular Evolution.pdf | 2020-05-25 00:07 | 4.5M | |
| New Doc.pdf | 2020-05-18 15:40 | 0 | |
| New Doc12.pdf | 2020-05-18 15:44 | 2.1M | |
| New Doc 2020-05-27 1..> | 2020-05-28 13:52 | 2.0M | |
| New Doc 2020-05-27 1..> | 2020-05-28 13:52 | 1.3M | |
| New Doc 2020-05-31 0..> | 2020-06-01 20:10 | 2.0M | |
| New Doc 2020-06-01 1..> | 2020-06-01 20:10 | 1.0M | |
| Onychophora.pdf | 2020-07-08 15:20 | 414K | |
| Osmoregulation AP Mi..> | 2020-06-01 20:10 | 2.1M | |
| PG II 202 ammonoteli..> | 2020-05-19 10:54 | 627K | |
| PG II 202 catecholam..> | 2020-05-26 14:42 | 696K | |
| PG II 202 deaminatio..> | 2020-05-19 10:54 | 575K | |
| PG II 202 glutathion..> | 2020-05-26 14:42 | 667K | |
| PG II 203 tick vecto..> | 2020-05-19 10:54 | 477K | |
| PG II host parasite.pdf | 2020-05-31 01:27 | 472K | |
| PG IV neuro immuno (..> | 2020-05-13 21:56 | 748K | |
| PG IV neuro immuno (..> | 2020-05-13 21:56 | 919K | |
| PG IV neuro immuno (..> | 2020-05-13 21:56 | 1.3M | |
| PG IV neuro immuno (..> | 2020-05-26 14:42 | 568K | |
| Physiological Activi..> | 2020-04-21 02:36 | 9.0M | |
| Pineal_Gland.pdf | 2020-04-08 18:37 | 417K | |
| RIA-1.pdf | 2020-06-01 20:10 | 289K | |
| Replication1Ch5.pdf | 2020-04-09 16:30 | 2.8M | |
| Respiration_in_Arthr..> | 2020-04-04 20:55 | 625K | |
| Respiratory.pdf | 2020-04-05 00:04 | 604K | |
| SEC - IV (UG).pdf | 2020-04-17 01:29 | 7.4M | |
| Sem VI Amniocentesis..> | 2020-05-08 22:14 | 583K | |
| Sem VI ESC.pdf | 2020-05-08 22:14 | 493K | |
| Sem VI IVF.pdf | 2020-05-08 22:14 | 407K | |
| Study Material _Oper..> | 2020-04-26 21:08 | 25M | |
| TYPES_MOUTHPAR.pdf | 2020-04-05 01:15 | 1.5M | |
| The_vertebrate_heart..> | 2020-04-26 20:58 | 907K | |
| UG IV C8T receptor.pdf | 2020-05-29 21:33 | 742K | |
| UG VI teratogenesis.pdf | 2020-04-22 23:18 | 468K | |
| UG VI trophallaxis -..> | 2020-04-17 01:27 | 438K | |
| VIII-Cell.pdf | 2020-05-10 21:25 | 8.2M | |
| Vaccine_Study Materi..> | 2020-05-09 19:55 | 7.4M | |
| Voice 001.m4a | 2020-05-04 14:57 | 9.6M | |
| ZOO61.pdf | 2020-04-15 00:49 | 3.8M | |
| ZOO62.pdf | 2020-04-15 00:49 | 165K | |
| ZOO63.pdf | 2020-04-15 00:50 | 474K | |
| ZOO64.pdf | 2020-04-15 00:51 | 1.2M | |
| ZOO65.pdf | 2020-04-15 00:51 | 641K | |
| ZOO66.pdf | 2020-04-15 00:53 | 2.7M | |
| ZOOcc141.pdf | 2020-04-15 00:51 | 155K | |
| ZOOcc142.pdf | 2020-04-15 00:52 | 261K | |
| carbohydrates.pdf | 2020-04-09 16:29 | 1.6M | |
| cardiac_cycle.pdf | 2020-04-13 23:30 | 3.0M | |
| cardiacoutput bp C.C..> | 2020-04-19 00:37 | 11M | |
| cc9i.pdf | 2020-04-08 02:04 | 6.6M | |
| cc10immunology.pdf | 2020-04-12 00:46 | 5.3M | |
| circulatory.pdf | 2020-04-04 23:39 | 533K | |
| circulatory_system_i..> | 2020-04-04 23:34 | 533K | |
| ecdysis.pdf | 2020-04-05 00:02 | 588K | |
| elimentary_canal.pdf | 2020-04-05 00:03 | 910K | |
| entomology.pdf | 2020-04-08 20:04 | 7.5M | |
| hypersensitivity-an-..> | 2020-04-26 20:58 | 1.0M | |
| insect_head.pdf | 2020-04-05 01:15 | 1.1M | |
| main.pdf | 2020-04-05 01:24 | 581K | |
| mcb110_s2008_4signal..> | 2020-05-10 21:26 | 9.8M | |
| mfsnandzoo.pdf | 2020-05-04 15:09 | 1.0M | |
| osmoregulation.pdf | 2020-06-01 20:10 | 1.4M | |
| pg2.pdf | 2020-04-09 16:42 | 1.3M | |
| zooMHC.pdf | 2020-04-04 21:02 | 9.5M | |
| zoocbcs.pdf | 2020-04-04 20:40 | 1.9M | |
| zoogen.pdf | 2020-04-04 21:31 | 4.3M | |
| zoogenLake.pdf | 2020-04-04 22:54 | 3.2M | |